EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O3 |
| Net Charge | 0 |
| Average Mass | 180.203 |
| Monoisotopic Mass | 180.07864 |
| SMILES | COc1cc(/C=C/CO)ccc1O |
| InChI | InChI=1S/C10H12O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-5,7,11-12H,6H2,1H3/b3-2+ |
| InChIKey | JMFRWRFFLBVWSI-NSCUHMNNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera ligustica (ncbitaxon:7469) | - | PubMed (12676987) | |
| Brassica napus (ncbitaxon:3708) | leaf lamina (BTO:0000719) | MetaboLights (MTBLS309) | From MetaboLights |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. monolignol A metabolite of plant origin (phytochemical) which acts as a source material for biosynthesis of both lignans and lignin. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coniferol (CHEBI:17745) has functional parent (E)-cinnamyl alcohol (CHEBI:33227) |
| coniferol (CHEBI:17745) has role animal metabolite (CHEBI:75767) |
| coniferol (CHEBI:17745) has role monolignol (CHEBI:64477) |
| coniferol (CHEBI:17745) has role mouse metabolite (CHEBI:75771) |
| coniferol (CHEBI:17745) has role pheromone (CHEBI:26013) |
| coniferol (CHEBI:17745) has role plant metabolite (CHEBI:76924) |
| coniferol (CHEBI:17745) has role volatile oil component (CHEBI:27311) |
| coniferol (CHEBI:17745) is a guaiacols (CHEBI:134251) |
| coniferol (CHEBI:17745) is a phenylpropanoid (CHEBI:26004) |
| Incoming Relation(s) |
| trans-coniferyl alcohol diacetate (CHEBI:86578) has functional parent coniferol (CHEBI:17745) |
| buddlenol B (CHEBI:86632) has functional parent coniferol (CHEBI:17745) |
| coniferin (CHEBI:16220) has functional parent coniferol (CHEBI:17745) |
| coniferyl p-coumarate (CHEBI:86599) has functional parent coniferol (CHEBI:17745) |
| coniferyl acetate (CHEBI:47905) has functional parent coniferol (CHEBI:17745) |
| coniferyl benzoate (CHEBI:86598) has functional parent coniferol (CHEBI:17745) |
| coniferyl ester (CHEBI:64292) has functional parent coniferol (CHEBI:17745) |
| dehydrodiconiferyl alcohol (CHEBI:91184) has functional parent coniferol (CHEBI:17745) |
| glycosmisic acid (CHEBI:91209) has functional parent coniferol (CHEBI:17745) |
| guaiacyl lignin (CHEBI:64475) has functional parent coniferol (CHEBI:17745) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) has functional parent coniferol (CHEBI:17745) |
| pinoresinol (CHEBI:8225) has functional parent coniferol (CHEBI:17745) |
| simulanol (CHEBI:86940) has functional parent coniferol (CHEBI:17745) |
| IUPAC Name |
|---|
| 4-[(1E)-3-hydroxyprop-1-en-1-yl]-2-methoxyphenol |
| Synonyms | Source |
|---|---|
| 4-[(1E)-3-hydroxy-1-propenyl]-2-methoxyphenol | NIST Chemistry WebBook |
| 4-(3-hydroxy-1-propenyl)-2-methoxyphenol | ChEBI |
| 4-(3-Hydroxy-1-propenyl)-2-methoxyphenol | KEGG COMPOUND |
| Coniferol | KEGG COMPOUND |
| Coniferyl alcohol | KEGG COMPOUND |
| trans-coniferol | HMDB |
| UniProt Name | Source |
|---|---|
| (E)-coniferol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000614 | KNApSAcK |
| C00590 | KEGG COMPOUND |
| Coniferyl_alcohol | Wikipedia |
| CONIFERYL-ALCOHOL | MetaCyc |
| FDB015496 | FooDB |
| HMDB0012915 | HMDB |
| N7I | PDBeChem |
| Citations |
|---|