EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O4 |
| Net Charge | 0 |
| Average Mass | 284.311 |
| Monoisotopic Mass | 284.10486 |
| SMILES | COc1cc(/C=C/COC(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C17H16O4/c1-20-16-12-13(9-10-15(16)18)6-5-11-21-17(19)14-7-3-2-4-8-14/h2-10,12,18H,11H2,1H3/b6-5+ |
| InChIKey | LAAPRQODJPXAHC-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Populus tremuloides (ncbitaxon:3693) | - | PubMed (24248582) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coniferyl benzoate (CHEBI:86598) has functional parent coniferol (CHEBI:17745) |
| coniferyl benzoate (CHEBI:86598) has role allelochemical (CHEBI:62215) |
| coniferyl benzoate (CHEBI:86598) has role antifeedant (CHEBI:22583) |
| coniferyl benzoate (CHEBI:86598) has role plant metabolite (CHEBI:76924) |
| coniferyl benzoate (CHEBI:86598) is a benzoate ester (CHEBI:36054) |
| coniferyl benzoate (CHEBI:86598) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-yl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3146188 | Reaxys |
| Citations |
|---|