EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36O11 |
| Net Charge | 0 |
| Average Mass | 584.618 |
| Monoisotopic Mass | 584.22576 |
| SMILES | COc1cc(C(O)C(CO)Oc2c(OC)cc(C3Oc4c(OC)cc(/C=C/CO)cc4C3CO)cc2OC)ccc1O |
| InChI | InChI=1S/C31H36O11/c1-37-23-12-18(7-8-22(23)35)28(36)27(16-34)41-31-25(39-3)13-19(14-26(31)40-4)29-21(15-33)20-10-17(6-5-9-32)11-24(38-2)30(20)42-29/h5-8,10-14,21,27-29,32-36H,9,15-16H2,1-4H3/b6-5+ |
| InChIKey | LCXGTSCVCJANHX-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buddlenol B (CHEBI:86632) has functional parent coniferol (CHEBI:17745) |
| buddlenol B (CHEBI:86632) has functional parent guaiacylglycerol (CHEBI:53663) |
| buddlenol B (CHEBI:86632) has role plant metabolite (CHEBI:76924) |
| buddlenol B (CHEBI:86632) is a 1-benzofurans (CHEBI:38830) |
| buddlenol B (CHEBI:86632) is a dimethoxybenzene (CHEBI:51681) |
| buddlenol B (CHEBI:86632) is a guaiacyl lignin (CHEBI:64475) |
| buddlenol B (CHEBI:86632) is a phenols (CHEBI:33853) |
| buddlenol B (CHEBI:86632) is a primary alcohol (CHEBI:15734) |
| buddlenol B (CHEBI:86632) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-2-(4-{3-(hydroxymethyl)-5-[(1E)-3-hydroxyprop-1-en-1-yl]-7-methoxy-2,3-dihydro-1-benzofuran-2-yl}-2,6-dimethoxyphenoxy)propane-1,3-diol |
| Synonym | Source |
|---|---|
| G(8-O-4)S(8-5)G | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6554135 | Reaxys |
| Citations |
|---|