EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3O2.C63H85N8O17 |
| Net Charge | 0 |
| Average Mass | 1285.456 |
| Monoisotopic Mass | 1284.61657 |
| SMILES | CC(=O)[O-].[H][C@@]12C[C@@H](O)CN1C(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)c1ccc(-c3ccc(-c4ccc(OCCCCC)cc4)cc3)cc1)C[C@@H](O)[C@@H](OCC[N+](C)(C)C)NC(=O)[C@]1([H])[C@@H](O)[C@@H](C)CN1C(=O)[C@H]([C@@H](C)O)NC(=O)[C@H]([C@H](O)[C@@H](O)c1ccc(O)cc1)NC2=O |
| InChI | InChI=1S/C63H84N8O17.C2H4O2/c1-8-9-10-28-87-45-25-21-40(22-26-45)38-13-11-37(12-14-38)39-15-17-42(18-16-39)56(80)64-46-31-48(76)61(88-29-27-71(5,6)7)68-60(84)52-53(77)34(2)32-70(52)63(86)50(36(4)73)66-59(83)51(55(79)54(78)41-19-23-43(74)24-20-41)67-58(82)47-30-44(75)33-69(47)62(85)49(35(3)72)65-57(46)81;1-2(3)4/h11-26,34-36,44,46-55,61,72-73,75-79H,8-10,27-33H2,1-7H3,(H5-,64,65,66,67,68,74,80,81,82,83,84);1H3,(H,3,4)/t34-,35+,36+,44+,46-,47-,48+,49-,50-,51-,52-,53-,54-,55-,61+;/m0./s1 |
| InChIKey | MXMWJAPNUIKPGF-YOFVRWEXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.4.1.34 (1,3-beta-glucan synthase) inhibitor A EC 2.4.1.* (hexosyltransferase) inhibitor that inhibits the action of 1,3-β-glucan synthase (EC 2.4.1.34). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rezafungin acetate (CHEBI:230470) has part rezafungin (CHEBI:229680) |
| rezafungin acetate (CHEBI:230470) is a acetate salt (CHEBI:59230) |
| rezafungin acetate (CHEBI:230470) is a antibiotic antifungal drug (CHEBI:87113) |
| rezafungin acetate (CHEBI:230470) is a echinocandin (CHEBI:57248) |
| rezafungin acetate (CHEBI:230470) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 2-{[(2R,6S,9S,11R,12R,14aS,15S,16S,20S,23S,25aS)-23-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-2,11,15-trihydroxy-6,20-bis[(1R)-1-hydroxyethyl]-16-methyl-5,8,14,19,22,25-hexaoxo-9-({[4''-(pentyloxy)[1,1':4',1''-terphenyl]-4-yl]carbonyl}amino)tetracosahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacyclohenicosin-12-yl]oxy}-N,N,N-trimethylethanaminium acetate |
| INNs | Source |
|---|---|
| acetato de rezafungina | WHO MedNet |
| rezafungini acetas | WHO MedNet |
| rezafungin acetate | WHO MedNet |
| acétate de rézafungine | WHO MedNet |
| Synonym | Source |
|---|---|
| biafungin acetate | ChEBI |
| Brand Name | Source |
|---|---|
| Rezzayo | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11198 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:1631754-41-0 | KEGG DRUG |
| Citations |
|---|