EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C63H85N8O17 |
| Net Charge | +1 |
| Average Mass | 1226.412 |
| Monoisotopic Mass | 1225.60272 |
| SMILES | [H][C@@]12C[C@@H](O)CN1C(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)c1ccc(-c3ccc(-c4ccc(OCCCCC)cc4)cc3)cc1)C[C@@H](O)[C@@H](OCC[N+](C)(C)C)NC(=O)[C@]1([H])[C@@H](O)[C@@H](C)CN1C(=O)[C@H]([C@@H](C)O)NC(=O)[C@H]([C@H](O)[C@@H](O)c1ccc(O)cc1)NC2=O |
| InChI | InChI=1S/C63H84N8O17/c1-8-9-10-28-87-45-25-21-40(22-26-45)38-13-11-37(12-14-38)39-15-17-42(18-16-39)56(80)64-46-31-48(76)61(88-29-27-71(5,6)7)68-60(84)52-53(77)34(2)32-70(52)63(86)50(36(4)73)66-59(83)51(55(79)54(78)41-19-23-43(74)24-20-41)67-58(82)47-30-44(75)33-69(47)62(85)49(35(3)72)65-57(46)81/h11-26,34-36,44,46-55,61,72-73,75-79H,8-10,27-33H2,1-7H3,(H5-,64,65,66,67,68,74,80,81,82,83,84)/p+1/t34-,35+,36+,44+,46-,47-,48+,49-,50-,51-,52-,53-,54-,55-,61+/m0/s1 |
| InChIKey | LNFCWEXGZIEGJW-TXSVMFMRSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.4.1.34 (1,3-beta-glucan synthase) inhibitor A EC 2.4.1.* (hexosyltransferase) inhibitor that inhibits the action of 1,3-β-glucan synthase (EC 2.4.1.34). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rezafungin (CHEBI:229680) is a antibiotic antifungal drug (CHEBI:87113) |
| rezafungin (CHEBI:229680) is a aromatic ether (CHEBI:35618) |
| rezafungin (CHEBI:229680) is a azamacrocycle (CHEBI:52898) |
| rezafungin (CHEBI:229680) is a echinocandin (CHEBI:57248) |
| rezafungin (CHEBI:229680) is a homodetic cyclic peptide (CHEBI:24613) |
| rezafungin (CHEBI:229680) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| rezafungin acetate (CHEBI:230470) has part rezafungin (CHEBI:229680) |
| IUPAC Name |
|---|
| 2-{[(2R,6S,9S,11R,12R,14aS,15S,16S,20S,23S,25aS)-23-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-2,11,15-trihydroxy-6,20-bis[(1R)-1-hydroxyethyl]-16-methyl-5,8,14,19,22,25-hexaoxo-9-({[4''-(pentyloxy)[1,1':4',1''-terphenyl]-4-yl]carbonyl}amino)tetracosahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacyclohenicosin-12-yl]oxy}-N,N,N-trimethylethanaminium |
| Synonyms | Source |
|---|---|
| rezafungin cation | DrugBank |
| CD101 | DrugBank |
| rezafungin ion | DrugBank |
| CD-101 | DrugBank |
| SP-3025 | DrugBank |
| SP 3025 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB16310 | DrugBank |
| D11197 | KEGG DRUG |
| Rezafungin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1396640-59-7 | DrugBank |
| Citations |
|---|