EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO4 |
| Net Charge | 0 |
| Average Mass | 225.244 |
| Monoisotopic Mass | 225.10011 |
| SMILES | COc1ccc(C[C@H]([NH3+])C(=O)[O-])cc1OC |
| InChI | InChI=1S/C11H15NO4/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5,12H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | VWTFNYVAFGYEKI-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethoxy-L-phenylalanine zwitterion (CHEBI:229727) has functional parent L-dopa zwitterion (CHEBI:57504) |
| 3,4-dimethoxy-L-phenylalanine zwitterion (CHEBI:229727) is a amino-acid zwitterion (CHEBI:35238) |
| 3,4-dimethoxy-L-phenylalanine zwitterion (CHEBI:229727) is tautomer of 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) |
| Incoming Relation(s) |
| 3,4-dimethoxy-L-phenylalanine (CHEBI:229731) is tautomer of 3,4-dimethoxy-L-phenylalanine zwitterion (CHEBI:229727) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(3,4-dimethoxyphenyl)propanoate |
| Synonyms | Source |
|---|---|
| 3-(3,4-dimethoxyphenyl)-L-alanine zwitterion | ChEBI |
| DMPA zwitterion | ChEBI |
| (S)-2-azaniumyl-3-(3,4-dimethoxyphenyl)propanoate | ChEBI |
| (S)-3,4-dimethoxyphenylalanine zwitterion | ChEBI |
| L-veratrylglycine zwitterion | ChEBI |
| β-(3,4-dimethoxyphenyl)-L-alanine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,4-dimethoxy-L-phenylalanine | UniProt |