EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N3O6 |
| Net Charge | 0 |
| Average Mass | 315.326 |
| Monoisotopic Mass | 315.14304 |
| SMILES | C[C@@]1(C(=O)N[C@@H](CCC(=O)O)C(=O)O)CCCN1C(=O)CN |
| InChI | InChI=1S/C13H21N3O6/c1-13(5-2-6-16(13)9(17)7-14)12(22)15-8(11(20)21)3-4-10(18)19/h8H,2-7,14H2,1H3,(H,15,22)(H,18,19)(H,20,21)/t8-,13-/m0/s1 |
| InChIKey | BUSXWGRAOZQTEY-SDBXPKJASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trofinetide (CHEBI:229599) has functional parent L-glutamic acid (CHEBI:16015) |
| trofinetide (CHEBI:229599) has functional parent glycine (CHEBI:15428) |
| trofinetide (CHEBI:229599) has role anti-inflammatory agent (CHEBI:67079) |
| trofinetide (CHEBI:229599) has role neuroprotective agent (CHEBI:63726) |
| trofinetide (CHEBI:229599) is a dicarboxylic acid (CHEBI:35692) |
| trofinetide (CHEBI:229599) is a primary amino compound (CHEBI:50994) |
| trofinetide (CHEBI:229599) is a pyrrolidinecarboxamide (CHEBI:46770) |
| trofinetide (CHEBI:229599) is a secondary carboxamide (CHEBI:140325) |
| trofinetide (CHEBI:229599) is a tertiary carboxamide (CHEBI:140326) |
| trofinetide (CHEBI:229599) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| glycyl-2-methyl-L-prolyl-L-glutamic acid |
| INNs | Source |
|---|---|
| trofinetida | WHO MedNet |
| trofinétide | WHO MedNet |
| trofinetide | WHO MedNet |
| trofinetidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| NNZ-2566 | SUBMITTER |
| NNZ 2566 | ChEBI |
| NNZ2566 | ChEBI |
| (2S)-2-({[(2S)-1-(aminoacetyl)-2-methylpyrrolidin-2-yl]carbonyl}amino)pentanedioic acid | IUPAC |
| (2S)-2-{[(2S)-1-(2-aminoacetyl)-2-methylpyrrolidine-2-carbonyl]amino}pentanedioic acid | ChEBI |
| Brand Name | Source |
|---|---|
| Daybue | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Trofinetide | Wikipedia |
| DB06045 | DrugBank |
| D12400 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:853400-76-7 | KEGG DRUG |
| Citations |
|---|