EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O2 |
| Net Charge | 0 |
| Average Mass | 206.205 |
| Monoisotopic Mass | 206.08038 |
| SMILES | [N-]=[N+]=Nc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C9H10N4O2/c10-8(9(14)15)5-6-1-3-7(4-2-6)12-13-11/h1-4,8H,5,10H2,(H,14,15) |
| InChIKey | NEMHIKRLROONTL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-azidophenylalanine (CHEBI:228217) is a aromatic amino acid (CHEBI:33856) |
| 4-azidophenylalanine (CHEBI:228217) is a azide (CHEBI:22680) |
| 4-azidophenylalanine (CHEBI:228217) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 4-azidophenylalanine (CHEBI:228217) is a phenylalanine derivative (CHEBI:25985) |
| Incoming Relation(s) |
| 4-azido-D-phenylalanine (CHEBI:228219) is a 4-azidophenylalanine (CHEBI:228217) |
| 4-azido-L-phenylalanine (CHEBI:228211) is a 4-azidophenylalanine (CHEBI:228217) |
| IUPAC Name |
|---|
| 4-azidophenylalanine |
| Synonyms | Source |
|---|---|
| p-azidophenylalanine | ChEBI |
| 2-amino-3-(4-azidophenyl)propanoic acid | IUPAC |
| 4-N3-phenylalanine | ChEBI |
| H-4-azido-Phe-OH | ChEBI |
| p-azido-Phe | ChEBI |
| Citations |
|---|