EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O2 |
| Net Charge | 0 |
| Average Mass | 206.205 |
| Monoisotopic Mass | 206.08038 |
| SMILES | [N-]=[N+]=Nc1ccc(C[C@@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C9H10N4O2/c10-8(9(14)15)5-6-1-3-7(4-2-6)12-13-11/h1-4,8H,5,10H2,(H,14,15)/t8-/m1/s1 |
| InChIKey | NEMHIKRLROONTL-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-azido-D-phenylalanine (CHEBI:228219) is a D-phenylalanine derivative (CHEBI:84143) |
| 4-azido-D-phenylalanine (CHEBI:228219) is a 4-azidophenylalanine (CHEBI:228217) |
| 4-azido-D-phenylalanine (CHEBI:228219) is enantiomer of 4-azido-L-phenylalanine (CHEBI:228211) |
| Incoming Relation(s) |
| 4-azido-L-phenylalanine (CHEBI:228211) is enantiomer of 4-azido-D-phenylalanine (CHEBI:228219) |
| IUPAC Name |
|---|
| 4-azido-D-phenylalanine |
| Synonyms | Source |
|---|---|
| p-azido-D-phenylalanine | ChEBI |
| 4-N3-D-phenylalanine | ChEBI |
| D-4-azidophenylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:328005-78-3 | ChEBI |