EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O2 |
| Net Charge | 0 |
| Average Mass | 268.316 |
| Monoisotopic Mass | 268.12118 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)O)CN2C |
| InChI | InChI=1S/C16H16N2O2/c1-18-8-10(16(19)20)5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18/h2-5,7,10,14,17H,6,8H2,1H3,(H,19,20)/t10-,14-/m1/s1 |
| InChIKey | ZAGRKAFMISFKIO-QMTHXVAHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysergic acid (CHEBI:6604) has parent hydride 6-methylergoline (CHEBI:2215) |
| lysergic acid (CHEBI:6604) is a ergoline alkaloid (CHEBI:60529) |
| Incoming Relation(s) |
| 6-allyl-8b-Carboxy-ergoline (CHEBI:174826) has functional parent lysergic acid (CHEBI:6604) |
| 6-Methyl-9,10-didehydroergoline-8-carboxylic acid (CHEBI:182503) has functional parent lysergic acid (CHEBI:6604) |
| IUPAC Name |
|---|
| (8R)-9,10-didehydro-6-methylergoline-8-carboxylic acid |
| Synonyms | Source |
|---|---|
| (8β)-9,10-didehydro-6-methylergoline-8-carboxylic acid | ChemIDplus |
| Lysergic acid | KEGG COMPOUND |