EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2 |
| Net Charge | 0 |
| Average Mass | 129.159 |
| Monoisotopic Mass | 129.07898 |
| SMILES | O=C(O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C6H11NO2/c8-6(9)5-2-1-3-7-4-5/h5,7H,1-4H2,(H,8,9)/t5-/m1/s1 |
| InChIKey | XJLSEXAGTJCILF-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-nipecotic acid (CHEBI:221278) is a nipecotic acid (CHEBI:116931) |
| (R)-nipecotic acid (CHEBI:221278) is enantiomer of (S)-nipecotic acid (CHEBI:222169) |
| (R)-nipecotic acid (CHEBI:221278) is tautomer of (R)-nipecotic acid zwitterion (CHEBI:60120) |
| Incoming Relation(s) |
| tiagabine (CHEBI:9586) has functional parent (R)-nipecotic acid (CHEBI:221278) |
| (S)-nipecotic acid (CHEBI:222169) is enantiomer of (R)-nipecotic acid (CHEBI:221278) |
| (R)-nipecotic acid zwitterion (CHEBI:60120) is tautomer of (R)-nipecotic acid (CHEBI:221278) |
| IUPAC Name |
|---|
| (3R)-piperidine-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| (3R)-hexahydronicotinic acid | ChEBI |
| (3R)-nipecotic acid | ChEBI |
| (3R)-(−)-piperidine-3-carboxylic acid | ChEBI |
| (−)-hexahydronicotinic acid | ChEBI |
| (R)-(−)-3-piperidinecarboxylic acid | ChEBI |
| (R)-hexahydronicotinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:81097 | Beilstein |