EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO2S2 |
| Net Charge | 0 |
| Average Mass | 375.559 |
| Monoisotopic Mass | 375.13267 |
| SMILES | Cc1ccsc1C(=CCCN1CCC[C@@H](C(=O)O)C1)c1sccc1C |
| InChI | InChI=1S/C20H25NO2S2/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | PBJUNZJWGZTSKL-MRXNPFEDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiagabine (CHEBI:9586) has functional parent (R)-nipecotic acid (CHEBI:221278) |
| tiagabine (CHEBI:9586) has role anticonvulsant (CHEBI:35623) |
| tiagabine (CHEBI:9586) has role GABA reuptake inhibitor (CHEBI:85384) |
| tiagabine (CHEBI:9586) is a piperidinemonocarboxylic acid (CHEBI:26148) |
| tiagabine (CHEBI:9586) is a tertiary amino compound (CHEBI:50996) |
| tiagabine (CHEBI:9586) is a thiophenes (CHEBI:26961) |
| tiagabine (CHEBI:9586) is a β-amino acid (CHEBI:33706) |
| tiagabine (CHEBI:9586) is conjugate base of tiagabine(1+) (CHEBI:85387) |
| Incoming Relation(s) |
| tiagabine(1+) (CHEBI:85387) is conjugate acid of tiagabine (CHEBI:9586) |
| IUPAC Name |
|---|
| (3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid |
| INNs | Source |
|---|---|
| tiagabina | ChemIDplus |
| tiagabine | WHO MedNet |
| tiagabine | ChemIDplus |
| tiagabinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (R)-(−)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid | ChEBI |
| (−)-(R)-1-(4,4-bis(3-methyl-2-thienyl)-3-butenyl)nipecotic acid | ChemIDplus |
| (−)-(R)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid | ChEBI |
| (R)-tiagabine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6375354 | Reaxys |
| CAS:115103-54-3 | ChemIDplus |
| CAS:115103-54-3 | KEGG COMPOUND |
| Citations |
|---|