EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO2S2 |
| Net Charge | 0 |
| Average Mass | 375.559 |
| Monoisotopic Mass | 375.13267 |
| SMILES | Cc1ccsc1C(=CCCN1CCC[C@@H](C(=O)O)C1)c1sccc1C |
| InChI | InChI=1S/C20H25NO2S2/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | PBJUNZJWGZTSKL-MRXNPFEDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anticonvulsant A drug used to prevent seizures or reduce their severity. GABA reuptake inhibitor A compound that inhibits the re-uptake of the neurotransmitter GABA from the synapse into the pre-synaptic neuron, so increasing the extracellular concentrations of the neurotransmitter and hence increasing neurotransmission. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiagabine (CHEBI:9586) has functional parent (R)-nipecotic acid (CHEBI:221278) |
| tiagabine (CHEBI:9586) has role anticonvulsant (CHEBI:35623) |
| tiagabine (CHEBI:9586) has role antipsychotic agent (CHEBI:35476) |
| tiagabine (CHEBI:9586) has role anxiolytic drug (CHEBI:35474) |
| tiagabine (CHEBI:9586) has role GABA reuptake inhibitor (CHEBI:85384) |
| tiagabine (CHEBI:9586) is a piperidinemonocarboxylic acid (CHEBI:26148) |
| tiagabine (CHEBI:9586) is a tertiary amino compound (CHEBI:50996) |
| tiagabine (CHEBI:9586) is a thiophenes (CHEBI:26961) |
| tiagabine (CHEBI:9586) is a β-amino acid (CHEBI:33706) |
| tiagabine (CHEBI:9586) is conjugate base of tiagabine(1+) (CHEBI:85387) |
| Incoming Relation(s) |
| tiagabine(1+) (CHEBI:85387) is conjugate acid of tiagabine (CHEBI:9586) |
| IUPAC Name |
|---|
| (3R)-1-[4,4-bis(3-methyl-2-thienyl)but-3-en-1-yl]piperidine-3-carboxylic acid |
| INNs | Source |
|---|---|
| tiagabina | ChemIDplus |
| tiagabine | ChemIDplus |
| tiagabine | WHO MedNet |
| tiagabinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| A-70569-1 | ChEMBL |
| Abbott-70569-1 | ChEMBL |
| ABBOTT-705691 FREE BASE | ChEMBL |
| ABBOTT-70569 FREE BASE | ChEMBL |
| ABT-569 FREE BASE | ChEMBL |
| (R)-(−)-1-[4,4-bis(3-methyl-2-thienyl)-3-butenyl]nipecotic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6375354 | Reaxys |
| CAS:115103-54-3 | ChemIDplus |
| CAS:115103-54-3 | KEGG COMPOUND |
| Citations |
|---|