EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2 |
| Net Charge | 0 |
| Average Mass | 129.159 |
| Monoisotopic Mass | 129.07898 |
| SMILES | O=C(O)C1CCCNC1 |
| InChI | InChI=1S/C6H11NO2/c8-6(9)5-2-1-3-7-4-5/h5,7H,1-4H2,(H,8,9) |
| InChIKey | XJLSEXAGTJCILF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nipecotic acid (CHEBI:116931) is a piperidinemonocarboxylic acid (CHEBI:26148) |
| nipecotic acid (CHEBI:116931) is a β-amino acid (CHEBI:33706) |
| Incoming Relation(s) |
| (R)-nipecotic acid (CHEBI:221278) is a nipecotic acid (CHEBI:116931) |
| (S)-nipecotic acid (CHEBI:222169) is a nipecotic acid (CHEBI:116931) |
| IUPAC Name |
|---|
| piperidine-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| Piperidine-3-carboxylic acid | ChEMBL |
| hexahydronicotinic acid | ChEBI |
| 3-piperidinecarboxylic acid | ChEBI |