EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8NO6P |
| Net Charge | 0 |
| Average Mass | 185.072 |
| Monoisotopic Mass | 185.00892 |
| SMILES | N[C@@H](COP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1 |
| InChIKey | BZQFBWGGLXLEPQ-REOHCLBHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (17765195) | ||
| - | PubMed (21988831) | ||
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (8017107) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor An EC 1.4.* (oxidoreductase acting on donor CH-NH2 group) inhibitor that interferes with the action of any glutamate synthase. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor An EC 4.3.1.* (ammonia-lyase) inhibitor that interferes with the action of serine-sulfate ammonia-lyase (EC 4.3.1.10). EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of O-acetylhomoserine aminocarboxypropyltransferase (EC 2.5.1.49). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-phospho-L-serine (CHEBI:15811) has role Escherichia coli metabolite (CHEBI:76971) |
| O-phospho-L-serine (CHEBI:15811) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| O-phospho-L-serine (CHEBI:15811) has role EC 1.4.7.1 [glutamate synthase (ferredoxin)] inhibitor (CHEBI:62089) |
| O-phospho-L-serine (CHEBI:15811) has role EC 2.5.1.49 (O-acetylhomoserine aminocarboxypropyltransferase) inhibitor (CHEBI:77089) |
| O-phospho-L-serine (CHEBI:15811) has role EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor (CHEBI:77090) |
| O-phospho-L-serine (CHEBI:15811) has role human metabolite (CHEBI:77746) |
| O-phospho-L-serine (CHEBI:15811) has role mouse metabolite (CHEBI:75771) |
| O-phospho-L-serine (CHEBI:15811) is a O-phosphoserine (CHEBI:37712) |
| O-phospho-L-serine (CHEBI:15811) is conjugate acid of O-phosphonato-L-serine(2−) (CHEBI:57524) |
| O-phospho-L-serine (CHEBI:15811) is enantiomer of O-phospho-D-serine (CHEBI:37713) |
| Incoming Relation(s) |
| O-phospho-L-serine-P-ethyl ester (CHEBI:234276) has functional parent O-phospho-L-serine (CHEBI:15811) |
| O-phospho-L-serine-P-methyl ester (CHEBI:234278) has functional parent O-phospho-L-serine (CHEBI:15811) |
| O-phosphonato-L-serine(2−) (CHEBI:57524) is conjugate base of O-phospho-L-serine (CHEBI:15811) |
| O-phospho-D-serine (CHEBI:37713) is enantiomer of O-phospho-L-serine (CHEBI:15811) |
| O-phospho-L-serine residue (CHEBI:45522) is substituent group from O-phospho-L-serine (CHEBI:15811) |
| IUPAC Name |
|---|
| O-phosphono-L-serine |
| INNs | Source |
|---|---|
| dexfosfoserina | WHO MedNet |
| dexfosfoserine | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(phosphonooxy)propanoic acid | IUPAC |
| 3-Phosphoserine | KEGG COMPOUND |
| dexfosfoserine | ChEMBL |
| Dexfosfoserine | KEGG COMPOUND |
| Dl-phosphoserine | ChEMBL |
| O-phosphoserine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3-phosphoserine | Wikipedia |
| 3-P-SERINE | MetaCyc |
| 4120 | DrugCentral |
| C00007287 | KNApSAcK |
| C01005 | KEGG COMPOUND |
| EP2444481 | Patent |
| HMDB0000272 | HMDB |
| SEP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726826 | Reaxys |
| Gmelin:675662 | Gmelin |
| CAS:407-41-0 | KEGG COMPOUND |
| CAS:407-41-0 | ChemIDplus |
| Citations |
|---|