EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12NO6P |
| Net Charge | 0 |
| Average Mass | 213.126 |
| Monoisotopic Mass | 213.04022 |
| SMILES | CCOP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12NO6P/c1-2-11-13(9,10)12-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10)/t4-/m0/s1 |
| InChIKey | ULHXUTHSGPNKSO-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-phospho-L-serine-P-ethyl ester (CHEBI:234276) has functional parent O-phospho-L-serine (CHEBI:15811) |
| O-phospho-L-serine-P-ethyl ester (CHEBI:234276) is a O-phosphoserine-P-ethyl ester (CHEBI:234275) |
| O-phospho-L-serine-P-ethyl ester (CHEBI:234276) is a L-serine derivative (CHEBI:84135) |
| IUPAC Name |
|---|
| O-[ethoxy(hydroxy)phosphoryl]-L-serine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-{[ethoxy(hydroxy)phosphoryl]oxy}propanoic acid | IUPAC |
| O-phosphoserine-P-ethyl ester | ChEBI |
| O-[(S)-ethoxy(hydroxy)phosphoryl]-L-serine | PDBeChem |
| (2S)-2-amino-3-[ethoxy(hydroxy)phosphoryl]oxypropanoic acid | ChEBI |
| L-serine, ethyl hydrogen phosphate (ester) | ChEBI |
| O-phospho-(L)serine-P-ethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MIR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:121071-26-9 | PubChem Compound |
| Citations |
|---|