EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:37713 - O-phospho-D-serine
| Formula | C3H8NO6P |
| Net Charge | 0 |
| Average Mass | 185.072 |
| Monoisotopic Mass | 185.00892 |
| SMILES | N[C@H](COP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m1/s1 |
| InChIKey | BZQFBWGGLXLEPQ-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-phospho-D-serine (CHEBI:37713) is a O-phosphoserine (CHEBI:37712) |
| O-phospho-D-serine (CHEBI:37713) is conjugate acid of O-phosphonatooxy-D-serine(2−) (CHEBI:58680) |
| O-phospho-D-serine (CHEBI:37713) is enantiomer of O-phospho-L-serine (CHEBI:15811) |
| Incoming Relation(s) |
| VPC 23019 (CHEBI:144948) has functional parent O-phospho-D-serine (CHEBI:37713) |
| O-phosphonatooxy-D-serine(2−) (CHEBI:58680) is conjugate base of O-phospho-D-serine (CHEBI:37713) |
| O-phospho-L-serine (CHEBI:15811) is enantiomer of O-phospho-D-serine (CHEBI:37713) |
| IUPAC Name |
|---|
| O-phosphono-D-serine |
| Synonyms | Source |
|---|---|
| D-O-Phosphoserine | KEGG COMPOUND |
| (2R)-2-amino-3-(phosphonooxy)propanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C02532 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1876423 | Gmelin |
| Reaxys:1726827 | Reaxys |