EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10NO6P |
| Net Charge | 0 |
| Average Mass | 199.099 |
| Monoisotopic Mass | 199.02457 |
| SMILES | COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H10NO6P/c1-10-12(8,9)11-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | OGIOVQXVFVIGHA-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-phospho-L-serine-P-methyl ester (CHEBI:234278) has functional parent O-phospho-L-serine (CHEBI:15811) |
| O-phospho-L-serine-P-methyl ester (CHEBI:234278) is a O-phosphoserine-P-methyl ester (CHEBI:234277) |
| O-phospho-L-serine-P-methyl ester (CHEBI:234278) is a L-serine derivative (CHEBI:84135) |
| IUPAC Name |
|---|
| O-[hydroxy(methoxy)phosphoryl]-L-serine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-{[hydroxy(methoxy)phosphoryl]oxy}propanoic acid | IUPAC |
| O-[(S)-hydroxy(methoxy)phosphoryl]-L-serine | PDBeChem |
| (2S)-2-amino-3-[hydroxy(methoxy)phosphoryl]oxypropanoic acid | ChEBI |
| O-phospho-L-serine-P-methylester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| OMH | PDBeChem |
| Citations |
|---|