EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11I4NO4 |
| Net Charge | 0 |
| Average Mass | 776.872 |
| Monoisotopic Mass | 776.68670 |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | XUIIKFGFIJCVMT-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). thyroid hormone Any hormone produced by the thyroid gland mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. |
| Application: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thyroxine (CHEBI:18332) has role antithyroid drug (CHEBI:50671) |
| L-thyroxine (CHEBI:18332) has role human metabolite (CHEBI:77746) |
| L-thyroxine (CHEBI:18332) has role mouse metabolite (CHEBI:75771) |
| L-thyroxine (CHEBI:18332) has role thyroid hormone (CHEBI:60311) |
| L-thyroxine (CHEBI:18332) is a L-phenylalanine derivative (CHEBI:84144) |
| L-thyroxine (CHEBI:18332) is a 2-halophenol (CHEBI:53291) |
| L-thyroxine (CHEBI:18332) is a iodophenol (CHEBI:24863) |
| L-thyroxine (CHEBI:18332) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-thyroxine (CHEBI:18332) is a thyroxine (CHEBI:30660) |
| L-thyroxine (CHEBI:18332) is conjugate acid of L-thyroxine(1−) (CHEBI:60302) |
| L-thyroxine (CHEBI:18332) is enantiomer of D-thyroxine (CHEBI:30659) |
| L-thyroxine (CHEBI:18332) is tautomer of L-thyroxine zwitterion (CHEBI:58448) |
| Incoming Relation(s) |
| desiccated thyroid extract (CHEBI:9584) has part L-thyroxine (CHEBI:18332) |
| L-thyroxine(1−) (CHEBI:60302) is conjugate base of L-thyroxine (CHEBI:18332) |
| D-thyroxine (CHEBI:30659) is enantiomer of L-thyroxine (CHEBI:18332) |
| L-thyroxine residue (CHEBI:90872) is substituent group from L-thyroxine (CHEBI:18332) |
| L-thyroxine zwitterion (CHEBI:58448) is tautomer of L-thyroxine (CHEBI:18332) |
| IUPAC Name |
|---|
| L-thyroxine |
| Synonyms | Source |
|---|---|
| 3,3',5,5'-tetraiodo-L-thyronine | ChemIDplus |
| 3,5,3',5'-TETRAIODO-L-THYRONINE | PDBeChem |
| 3,5,3',5'-tetraiodo-L-thyronine | ChemIDplus |
| 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine | IUPAC |
| O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine | PDBeChem |
| Levothyroxin | KEGG COMPOUND |
| Citations |
|---|