EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18332 - L-thyroxine
| Formula | C15H11I4NO4 |
| Net Charge | 0 |
| Average Mass | 776.872 |
| Monoisotopic Mass | 776.68670 |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | XUIIKFGFIJCVMT-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. thyroid hormone Any hormone produced by the thyroid gland human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. hypoglycemic agent A drug which lowers the blood glucose level. antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thyroxine (CHEBI:18332) has role antiinfective agent (CHEBI:35441) |
| L-thyroxine (CHEBI:18332) has role antipsychotic agent (CHEBI:35476) |
| L-thyroxine (CHEBI:18332) has role antithyroid drug (CHEBI:50671) |
| L-thyroxine (CHEBI:18332) has role human metabolite (CHEBI:77746) |
| L-thyroxine (CHEBI:18332) has role hypoglycemic agent (CHEBI:35526) |
| L-thyroxine (CHEBI:18332) has role mouse metabolite (CHEBI:75771) |
| L-thyroxine (CHEBI:18332) has role thyroid hormone (CHEBI:60311) |
| L-thyroxine (CHEBI:18332) is a L-phenylalanine derivative (CHEBI:84144) |
| L-thyroxine (CHEBI:18332) is a 2-halophenol (CHEBI:53291) |
| L-thyroxine (CHEBI:18332) is a iodophenol (CHEBI:24863) |
| L-thyroxine (CHEBI:18332) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-thyroxine (CHEBI:18332) is a thyroxine (CHEBI:30660) |
| L-thyroxine (CHEBI:18332) is conjugate acid of L-thyroxine(1−) (CHEBI:60302) |
| L-thyroxine (CHEBI:18332) is enantiomer of D-thyroxine (CHEBI:30659) |
| L-thyroxine (CHEBI:18332) is tautomer of L-thyroxine zwitterion (CHEBI:58448) |
| Incoming Relation(s) |
| desiccated thyroid extract (CHEBI:9584) has part L-thyroxine (CHEBI:18332) |
| L-thyroxine(1−) (CHEBI:60302) is conjugate base of L-thyroxine (CHEBI:18332) |
| D-thyroxine (CHEBI:30659) is enantiomer of L-thyroxine (CHEBI:18332) |
| L-thyroxine residue (CHEBI:90872) is substituent group from L-thyroxine (CHEBI:18332) |
| L-thyroxine zwitterion (CHEBI:58448) is tautomer of L-thyroxine (CHEBI:18332) |
| IUPAC Name |
|---|
| L-thyroxine |
| Synonyms | Source |
|---|---|
| 3,3',5,5'-tetraiodo-L-thyronine | ChemIDplus |
| 3,5,3',5'-TETRAIODO-L-THYRONINE | PDBeChem |
| 3,5,3',5'-tetraiodo-L-thyronine | ChemIDplus |
| 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine | IUPAC |
| O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine | PDBeChem |
| Levothyroxin | KEGG COMPOUND |
| Citations |
|---|