EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11I4NO4 |
| Net Charge | 0 |
| Average Mass | 776.872 |
| Monoisotopic Mass | 776.68670 |
| SMILES | [NH3+][C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | XUIIKFGFIJCVMT-LBPRGKRZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thyroxine zwitterion (CHEBI:58448) is a thyroxine zwitterion (CHEBI:305790) |
| L-thyroxine zwitterion (CHEBI:58448) is tautomer of L-thyroxine (CHEBI:18332) |
| Incoming Relation(s) |
| L-thyroxine sulfate(1−) (CHEBI:176512) has functional parent L-thyroxine zwitterion (CHEBI:58448) |
| L-thyroxine (CHEBI:18332) is tautomer of L-thyroxine zwitterion (CHEBI:58448) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate |
| UniProt Name | Source |
|---|---|
| L-thyroxine | UniProt |