EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11I4NO4 |
| Net Charge | 0 |
| Average Mass | 776.872 |
| Monoisotopic Mass | 776.68670 |
| SMILES | N[C@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m1/s1 |
| InChIKey | XUIIKFGFIJCVMT-GFCCVEGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-thyroxine (CHEBI:30659) is a D-tyrosine derivative (CHEBI:84124) |
| D-thyroxine (CHEBI:30659) is a thyroxine (CHEBI:30660) |
| D-thyroxine (CHEBI:30659) is enantiomer of L-thyroxine (CHEBI:18332) |
| Incoming Relation(s) |
| L-thyroxine (CHEBI:18332) is enantiomer of D-thyroxine (CHEBI:30659) |
| IUPAC Name |
|---|
| D-thyroxine |
| Synonyms | Source |
|---|---|
| dextrothyroxine | ChemIDplus |
| O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-D-tyrosine | ChemIDplus |
| DT4 | ChEBI |
| D-T4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Dextrothyroxine | Wikipedia |
| DB00509 | DrugBank |
| 846 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2954910 | Beilstein |
| CAS:51-49-0 | ChemIDplus |
| Citations |
|---|