EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10I4NO4 |
| Net Charge | -1 |
| Average Mass | 775.864 |
| Monoisotopic Mass | 775.67942 |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/p-1/t12-/m0/s1 |
| InChIKey | XUIIKFGFIJCVMT-LBPRGKRZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thyroxine(1−) (CHEBI:60302) is a monocarboxylic acid anion (CHEBI:35757) |
| L-thyroxine(1−) (CHEBI:60302) is a α-amino-acid anion (CHEBI:33558) |
| L-thyroxine(1−) (CHEBI:60302) is conjugate base of L-thyroxine (CHEBI:18332) |
| Incoming Relation(s) |
| levothyroxine sodium anhydrous (CHEBI:6446) has part L-thyroxine(1−) (CHEBI:60302) |
| L-thyroxine (CHEBI:18332) is conjugate acid of L-thyroxine(1−) (CHEBI:60302) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate |
| Synonyms | Source |
|---|---|
| L-thyroxine anion | ChEBI |
| levothyroxine anion | ChEBI |
| levothyroxine(1−) | ChEBI |
| (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propionate | ChEBI |
| Citations |
|---|