EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O3 |
| Net Charge | 0 |
| Average Mass | 208.217 |
| Monoisotopic Mass | 208.08479 |
| SMILES | Nc1ccccc1C(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | YGPSJZOEDVAXAB-QMMMGPOBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-kynurenine (CHEBI:16946) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-kynurenine (CHEBI:16946) has role human metabolite (CHEBI:77746) |
| L-kynurenine (CHEBI:16946) has role mouse metabolite (CHEBI:75771) |
| L-kynurenine (CHEBI:16946) is a kynurenine (CHEBI:28683) |
| L-kynurenine (CHEBI:16946) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-kynurenine (CHEBI:16946) is conjugate acid of L-kynureninate (CHEBI:67010) |
| L-kynurenine (CHEBI:16946) is enantiomer of D-kynurenine (CHEBI:86262) |
| L-kynurenine (CHEBI:16946) is tautomer of L-kynurenine zwitterion (CHEBI:57959) |
| Incoming Relation(s) |
| N-formyl-L-kynurenine (CHEBI:30249) has functional parent L-kynurenine (CHEBI:16946) |
| L-kynureninate (CHEBI:67010) is conjugate base of L-kynurenine (CHEBI:16946) |
| D-kynurenine (CHEBI:86262) is enantiomer of L-kynurenine (CHEBI:16946) |
| L-kynurenine zwitterion (CHEBI:57959) is tautomer of L-kynurenine (CHEBI:16946) |
| IUPAC Name |
|---|
| 3-(2-aminobenzoyl)-L-alanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid | IUPAC |
| 3-Anthraniloyl-L-alanine | KEGG COMPOUND |
| KYNURENINE | PDBeChem |
| L-Kynurenine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00007604 | KNApSAcK |
| C00328 | KEGG COMPOUND |
| CPD-14736 | MetaCyc |
| DB02070 | DrugBank |
| HMDB0000684 | HMDB |
| KYN | PDBeChem |
| Kynurenine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2942333 | Reaxys |
| CAS:2922-83-0 | KEGG COMPOUND |
| CAS:2922-83-0 | ChemIDplus |
| Citations |
|---|