EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N2O3 |
| Net Charge | -1 |
| Average Mass | 207.209 |
| Monoisotopic Mass | 207.07752 |
| SMILES | Nc1ccccc1C(=O)C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/p-1/t8-/m0/s1 |
| InChIKey | YGPSJZOEDVAXAB-QMMMGPOBSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-kynureninate (CHEBI:67010) has role human metabolite (CHEBI:77746) |
| L-kynureninate (CHEBI:67010) is a L-α-amino acid anion (CHEBI:59814) |
| L-kynureninate (CHEBI:67010) is a kynureninate (CHEBI:67008) |
| L-kynureninate (CHEBI:67010) is conjugate base of L-kynurenine (CHEBI:16946) |
| Incoming Relation(s) |
| L-kynurenine (CHEBI:16946) is conjugate acid of L-kynureninate (CHEBI:67010) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoate |
| Synonym | Source |
|---|---|
| 3-(2-aminobenzoyl)-L-alanine(1−) | ChEBI |