EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O3 |
| Net Charge | 0 |
| Average Mass | 208.217 |
| Monoisotopic Mass | 208.08479 |
| SMILES | Nc1ccccc1C(=O)C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | YGPSJZOEDVAXAB-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-kynurenine zwitterion (CHEBI:57959) is a amino-acid zwitterion (CHEBI:35238) |
| L-kynurenine zwitterion (CHEBI:57959) is tautomer of L-kynurenine (CHEBI:16946) |
| Incoming Relation(s) |
| 3-hydroxy-4-methyl-L-kynurenine zwitterion (CHEBI:141609) has functional parent L-kynurenine zwitterion (CHEBI:57959) |
| D-kynurenine zwitterion (CHEBI:747001) is enantiomer of L-kynurenine zwitterion (CHEBI:57959) |
| L-kynurenine (CHEBI:16946) is tautomer of L-kynurenine zwitterion (CHEBI:57959) |
| IUPAC Name |
|---|
| (2S)-4-(2-aminophenyl)-2-azaniumyl-4-oxobutanoate |
| Synonym | Source |
|---|---|
| (2S)-4-(2-aminophenyl)-2-ammonio-4-oxobutanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| L-kynurenine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14736 | MetaCyc |