EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO5 |
| Net Charge | 0 |
| Average Mass | 163.129 |
| Monoisotopic Mass | 163.04807 |
| SMILES | N[C@@H](C[C@@H](O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/t2-,3+/m0/s1 |
| InChIKey | HBDWQSHEVMSFGY-STHAYSLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythro-4-hydroxy-L-glutamic acid (CHEBI:21285) has functional parent L-glutamic acid (CHEBI:16015) |
| erythro-4-hydroxy-L-glutamic acid (CHEBI:21285) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| erythro-4-hydroxy-L-glutamic acid (CHEBI:21285) is a 4-hydroxy-L-glutamic acid (CHEBI:32811) |
| erythro-4-hydroxy-L-glutamic acid (CHEBI:21285) is conjugate acid of erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) |
| Incoming Relation(s) |
| erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) is conjugate base of erythro-4-hydroxy-L-glutamic acid (CHEBI:21285) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-L-glutamic acid |
| Synonyms | Source |
|---|---|
| (2S,4R)-2-amino-4-hydroxypentanedioic acid | IUPAC |
| (4R)-4-hydroxy-L-glutamic acid | ChEBI |
| H-(2S,4R)-γ-hydroxy-Glu-OH | ChEBI |
| L-erythro-4-hydroxyglutamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05947 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725871 | Beilstein |
| CAS:2485-33-8 | ChEBI |