EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO5 |
| Net Charge | -1 |
| Average Mass | 162.121 |
| Monoisotopic Mass | 162.04080 |
| SMILES | [NH3+][C@@H](C[C@@H](O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/p-1/t2-,3+/m0/s1 |
| InChIKey | HBDWQSHEVMSFGY-STHAYSLISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) has functional parent L-glutamate(1−) (CHEBI:29985) |
| erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) has role human metabolite (CHEBI:77746) |
| erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) is a L-α-amino acid anion (CHEBI:59814) |
| erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) is a dicarboxylic acid monoanion (CHEBI:35695) |
| erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) is conjugate base of erythro-4-hydroxy-L-glutamic acid (CHEBI:21285) |
| Incoming Relation(s) |
| erythro-4-hydroxy-L-glutamic acid (CHEBI:21285) is conjugate acid of erythro-4-hydroxy-L-glutamate(1−) (CHEBI:6331) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-L-glutamate |
| Synonym | Source |
|---|---|
| (2S,4R)-2-ammonio-4-hydroxypentanedioate | IUPAC |
| UniProt Name | Source |
|---|---|
| (4S)-4-hydroxy-L-glutamate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05947 | KEGG COMPOUND |