EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N4O9P |
| Net Charge | 0 |
| Average Mass | 456.348 |
| Monoisotopic Mass | 456.10461 |
| SMILES | Cc1cc2nc3c(=O)nc(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)c2cc1C |
| InChI | InChI=1S/C17H21N4O9P/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H,20,25,26)(H2,27,28,29)/t11-,12+,14-/m0/s1 |
| InChIKey | FVTCRASFADXXNN-SCRDCRAPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23500531) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FMN (CHEBI:17621) has role bacterial metabolite (CHEBI:76969) |
| FMN (CHEBI:17621) has role coenzyme (CHEBI:23354) |
| FMN (CHEBI:17621) has role cofactor (CHEBI:23357) |
| FMN (CHEBI:17621) has role human metabolite (CHEBI:77746) |
| FMN (CHEBI:17621) has role mouse metabolite (CHEBI:75771) |
| FMN (CHEBI:17621) is a flavin mononucleotide (CHEBI:24041) |
| FMN (CHEBI:17621) is a vitamin B2 (CHEBI:176838) |
| FMN (CHEBI:17621) is conjugate acid of FMN(3−) (CHEBI:58210) |
| Incoming Relation(s) |
| 8-carboxy-8-demethylriboflavin 5'-phosphate (CHEBI:140157) has functional parent FMN (CHEBI:17621) |
| 8-formyl-8-demethylriboflavin 5'-phosphate (CHEBI:140156) has functional parent FMN (CHEBI:17621) |
| FMN-N5-peroxide(2−) (CHEBI:176498) has functional parent FMN (CHEBI:17621) |
| FMN-L-threonine (CHEBI:74347) has functional parent FMN (CHEBI:17621) |
| prenyl-FMN (CHEBI:87749) has functional parent FMN (CHEBI:17621) |
| FMN(3−) (CHEBI:58210) is conjugate base of FMN (CHEBI:17621) |
| IUPAC Name |
|---|
| 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-5-O-phosphono-D-ribitol |
| Synonyms | Source |
|---|---|
| Flavin mononucleotide | KEGG COMPOUND |
| FLAVIN MONONUCLEOTIDE | PDBeChem |
| FMN | KEGG COMPOUND |
| riboflavin 5'-(dihydrogen phosphate) | ChemIDplus |
| riboflavin 5'-monophosphate | ChemIDplus |
| Riboflavin-5-phosphate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Gmelin:477717 | Gmelin |
| Reaxys:68086 | Reaxys |
| CAS:146-17-8 | KEGG COMPOUND |
| CAS:146-17-8 | ChemIDplus |
| Citations |
|---|