EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N4O10P |
| Net Charge | 0 |
| Average Mass | 470.331 |
| Monoisotopic Mass | 470.08388 |
| SMILES | [H]C(=O)c1cc2c(cc1C)nc1c(=O)nc(=O)nc-1n2C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C17H19N4O10P/c1-7-2-9-10(3-8(7)5-22)21(15-13(18-9)16(26)20-17(27)19-15)4-11(23)14(25)12(24)6-31-32(28,29)30/h2-3,5,11-12,14,23-25H,4,6H2,1H3,(H,20,26,27)(H2,28,29,30)/t11-,12+,14-/m0/s1 |
| InChIKey | OBDNCYQECBSXQY-SCRDCRAPSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-formyl-8-demethylriboflavin 5'-phosphate (CHEBI:140156) has functional parent FMN (CHEBI:17621) |
| 8-formyl-8-demethylriboflavin 5'-phosphate (CHEBI:140156) is a arenecarbaldehyde (CHEBI:33855) |
| 8-formyl-8-demethylriboflavin 5'-phosphate (CHEBI:140156) is a flavin mononucleotide (CHEBI:24041) |
| 8-formyl-8-demethylriboflavin 5'-phosphate (CHEBI:140156) is a ribitol phosphate (CHEBI:26554) |
| 8-formyl-8-demethylriboflavin 5'-phosphate (CHEBI:140156) is conjugate acid of 8-formyl-8-demethylriboflavin 5'-phosphate(3−) (CHEBI:139570) |
| Incoming Relation(s) |
| 8-formyl-8-demethylriboflavin 5'-phosphate(3−) (CHEBI:139570) is conjugate base of 8-formyl-8-demethylriboflavin 5'-phosphate (CHEBI:140156) |
| IUPAC Name |
|---|
| 1-deoxy-1-(8-formyl-7-methyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(H)-yl)-5-O-phosphono-D-ribitol |
| Synonyms | Source |
|---|---|
| 8-demethyl-8-formylriboflavin 5'-phosphate | ChEBI |
| 8-oxoriboflavin 5'-phosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19838 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29711594 | Reaxys |