EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N5O11P |
| Net Charge | 0 |
| Average Mass | 557.453 |
| Monoisotopic Mass | 557.15229 |
| SMILES | Cc1cc2nc3c(=O)nc(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O[C@H](C)[C@H](N)C(=O)O)c2cc1C |
| InChI | InChI=1S/C21H28N5O11P/c1-8-4-11-12(5-9(8)2)26(18-16(23-11)19(30)25-21(33)24-18)6-13(27)17(29)14(28)7-36-38(34,35)37-10(3)15(22)20(31)32/h4-5,10,13-15,17,27-29H,6-7,22H2,1-3H3,(H,31,32)(H,34,35)(H,25,30,33)/t10-,13+,14-,15+,17+/m1/s1 |
| InChIKey | HORDMJSRMPFAQP-JNDNVOJLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FMN-L-threonine (CHEBI:74347) has functional parent FMN (CHEBI:17621) |
| FMN-L-threonine (CHEBI:74347) is a L-threonine derivative (CHEBI:84189) |
| FMN-L-threonine (CHEBI:74347) is a flavin mononucleotide (CHEBI:24041) |
| FMN-L-threonine (CHEBI:74347) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| FMN-L-threonine residue (CHEBI:74346) is substituent group from FMN-L-threonine (CHEBI:74347) |
| IUPAC Name |
|---|
| (2S,3R)-2-amino-3-{[{[(2R,3S,4S)-5-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-2,3,4-trihydroxypentyl]oxy}(hydroxy)phosphoryl]oxy}butanoic acid |
| Synonyms | Source |
|---|---|
| O-(riboflavin 5'-phospho)-L-threonine | ChEBI |
| O-(riboflavin 5'-phospho)threonine | ChEBI |