EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87749 - prenyl-FMN
| Formula | C22H29N4O9P |
| Net Charge | 0 |
| Average Mass | 524.467 |
| Monoisotopic Mass | 524.16722 |
| SMILES | Cc1cc2c3c(c1C)C(C)(C)CC=[N+]3c1c(nc([O-])nc1=O)N2C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C22H29N4O9P/c1-10-7-12-16-15(11(10)2)22(3,4)5-6-25(16)17-19(23-21(31)24-20(17)30)26(12)8-13(27)18(29)14(28)9-35-36(32,33)34/h6-7,13-14,18,27-29H,5,8-9H2,1-4H3,(H3-,23,24,30,31,32,33,34)/t13-,14+,18-/m0/s1 |
| InChIKey | KOUJZPGFPGLHCZ-IYOUNJFTSA-N |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prenyl-FMN (CHEBI:87749) has functional parent D-ribitol 5-phosphate (CHEBI:16246) |
| prenyl-FMN (CHEBI:87749) has functional parent FMN (CHEBI:17621) |
| prenyl-FMN (CHEBI:87749) has role cofactor (CHEBI:23357) |
| prenyl-FMN (CHEBI:87749) is a flavin mononucleotide (CHEBI:24041) |
| prenyl-FMN (CHEBI:87749) is a organic heterotetracyclic compound (CHEBI:38163) |
| prenyl-FMN (CHEBI:87749) is a zwitterion (CHEBI:27369) |
| prenyl-FMN (CHEBI:87749) is conjugate acid of prenyl-FMN(2−) (CHEBI:87746) |
| Incoming Relation(s) |
| prenyl-FMN(2−) (CHEBI:87746) is conjugate base of prenyl-FMN (CHEBI:87749) |
| IUPAC Name |
|---|
| 1-deoxy-5-O-phosphono-1-(3,3,4,5-tetramethyl-9-oxido-11-oxo-2,3,10,11-tetrahydro-7H-quinolino[1,8-fg]pteridin-12-ium-7-yl)-D-ribitol |
| Synonyms | Source |
|---|---|
| prenylated FMN | ChEBI |
| prFMN | ChEBI |
| Citations |
|---|