EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | NCCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m1/s1 |
| InChIKey | KDXKERNSBIXSRK-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-lysine (CHEBI:16855) has role bacterial metabolite (CHEBI:76969) |
| D-lysine (CHEBI:16855) has role fungal metabolite (CHEBI:76946) |
| D-lysine (CHEBI:16855) is a D-α-amino acid (CHEBI:16733) |
| D-lysine (CHEBI:16855) is a lysine (CHEBI:25094) |
| D-lysine (CHEBI:16855) is conjugate acid of D-lysinate (CHEBI:32556) |
| D-lysine (CHEBI:16855) is conjugate base of D-lysinium(1+) (CHEBI:32557) |
| D-lysine (CHEBI:16855) is enantiomer of L-lysine (CHEBI:18019) |
| Incoming Relation(s) |
| D-lysine hydrochloride (CHEBI:53558) has part D-lysine (CHEBI:16855) |
| D-lysinium(1+) (CHEBI:32557) is conjugate acid of D-lysine (CHEBI:16855) |
| D-lysinate (CHEBI:32556) is conjugate base of D-lysine (CHEBI:16855) |
| L-lysine (CHEBI:18019) is enantiomer of D-lysine (CHEBI:16855) |
| N2-D-lysino group (CHEBI:32561) is substituent group from D-lysine (CHEBI:16855) |
| N6-D-lysino group (CHEBI:32562) is substituent group from D-lysine (CHEBI:16855) |
| D-lysine residue (CHEBI:29968) is substituent group from D-lysine (CHEBI:16855) |
| D-lysyl group (CHEBI:32559) is substituent group from D-lysine (CHEBI:16855) |
| IUPAC Names |
|---|
| (2R)-2,6-diaminohexanoic acid |
| D-lysine |
| Synonyms | Source |
|---|---|
| D-2,6-Diaminohexanoic acid | KEGG COMPOUND |
| DLY | PDBeChem |
| D-Lysine | KEGG COMPOUND |
| D-LYSINE | PDBeChem |
| (R)-2,6-diaminohexanoic acid | ChEBI |
| D-Lysin | ChEBI |
| Citations |
|---|