EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N2O2 |
| Net Charge | -1 |
| Average Mass | 145.182 |
| Monoisotopic Mass | 145.09825 |
| SMILES | NCCCC[C@@H](N)C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/p-1/t5-/m1/s1 |
| InChIKey | KDXKERNSBIXSRK-RXMQYKEDSA-M |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-lysinate (CHEBI:32556) has role bacterial metabolite (CHEBI:76969) |
| D-lysinate (CHEBI:32556) has role fungal metabolite (CHEBI:76946) |
| D-lysinate (CHEBI:32556) is a lysinate (CHEBI:32563) |
| D-lysinate (CHEBI:32556) is conjugate base of D-lysine (CHEBI:16855) |
| D-lysinate (CHEBI:32556) is enantiomer of L-lysinate (CHEBI:32550) |
| Incoming Relation(s) |
| D-lysine (CHEBI:16855) is conjugate acid of D-lysinate (CHEBI:32556) |
| L-lysinate (CHEBI:32550) is enantiomer of D-lysinate (CHEBI:32556) |
| IUPAC Name |
|---|
| D-lysinate |
| Synonyms | Source |
|---|---|
| (2R)-2,6-diaminohexanoate | IUPAC |
| D-lysinate(1−) | ChEBI |
| D-lysine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1484324 | Gmelin |