EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N2O5R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 203.173 |
| Monoisotopic Mass (excl. R groups) | 203.06680 |
| SMILES | *C(NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-L-glutamyl amino acid (CHEBI:15857) has functional parent L-glutamic acid (CHEBI:16015) |
| 5-L-glutamyl amino acid (CHEBI:15857) is a dipeptide (CHEBI:46761) |
| 5-L-glutamyl amino acid (CHEBI:15857) is conjugate acid of 5-L-glutamyl amino acid(1−) (CHEBI:77644) |
| Incoming Relation(s) |
| (2S,4R)-hypoglycin B (CHEBI:136293) is a 5-L-glutamyl amino acid (CHEBI:15857) |
| (2S,4S)-hypoglycin B (CHEBI:6332) is a 5-L-glutamyl amino acid (CHEBI:15857) |
| 5-L-glutamyl amino acid(1−) (CHEBI:77644) is conjugate base of 5-L-glutamyl amino acid (CHEBI:15857) |
| Synonyms | Source |
|---|---|
| 5-L-Glutamyl amino acid | KEGG COMPOUND |
| Nα-(L-γ-glutamyl) amino acid | ChEBI |
| L-gamma-Glutamyl amino acid | KEGG COMPOUND |
| L-γ-glutamyl amino acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03363 | KEGG COMPOUND |