EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2O5R |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 202.165 |
| Monoisotopic Mass (excl. R groups) | 202.05897 |
| SMILES | *C(NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-L-glutamyl amino acid(1−) (CHEBI:77644) is a peptide anion (CHEBI:60334) |
| 5-L-glutamyl amino acid(1−) (CHEBI:77644) is conjugate base of 5-L-glutamyl amino acid (CHEBI:15857) |
| Incoming Relation(s) |
| 5-L-glutamyl amino acid (CHEBI:15857) is conjugate acid of 5-L-glutamyl amino acid(1−) (CHEBI:77644) |
| UniProt Name | Source |
|---|---|
| 5-L-glutamyl amino acid | UniProt |