EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30245 - linoleate
| Formula | C18H31O2 |
| Net Charge | -1 |
| Average Mass | 279.444 |
| Monoisotopic Mass | 279.23295 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b7-6-,10-9- |
| InChIKey | OYHQOLUKZRVURQ-HZJYTTRNSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linoleate (CHEBI:30245) has functional parent 9-HPODE(1−) (CHEBI:146293) |
| linoleate (CHEBI:30245) has role human blood serum metabolite (CHEBI:85234) |
| linoleate (CHEBI:30245) has role plant metabolite (CHEBI:76924) |
| linoleate (CHEBI:30245) is a octadecadienoate (CHEBI:25626) |
| linoleate (CHEBI:30245) is conjugate base of linoleic acid (CHEBI:17351) |
| Incoming Relation(s) |
| (S)-3-hydroxylinoleoyl-CoA(4−) (CHEBI:233824) has functional parent linoleate (CHEBI:30245) |
| (9S),10-epoxy-(10,12Z)-octadecadienoate (CHEBI:143139) has functional parent linoleate (CHEBI:30245) |
| (9Z,12Z)-11-hydroxyoctadecadienoate (CHEBI:136522) has functional parent linoleate (CHEBI:30245) |
| N-linoleoylglycine(1−) (CHEBI:150011) has functional parent linoleate (CHEBI:30245) |
| 1,1',2-trilinoleoyl-2'-palmitoleoyl-cardiolipin(2−) (CHEBI:176427) has functional parent linoleate (CHEBI:30245) |
| 1,1',2-trioleoyl-2'-linoleoyl-cardiolipin(2−) (CHEBI:173223) has functional parent linoleate (CHEBI:30245) |
| 13-HODE(1−) (CHEBI:133819) has functional parent linoleate (CHEBI:30245) |
| 9-HODE(1−) (CHEBI:133820) has functional parent linoleate (CHEBI:30245) |
| trininoleoyl-monolysocardiolipin(2−) (CHEBI:156311) has functional parent linoleate (CHEBI:30245) |
| Calcium linoleate (CHEBI:31343) has part linoleate (CHEBI:30245) |
| tetralinoleoyl cardiolipin ketone(2−) (CHEBI:231791) has part linoleate (CHEBI:30245) |
| linoleic acid (CHEBI:17351) is conjugate acid of linoleate (CHEBI:30245) |
| IUPAC Name |
|---|
| (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| (9Z,12Z)-9,12-octadecadienoic acid, ion(1−) | ChemIDplus |
| (Z,Z)-9,12-octadecadienoic acid, ion(1−) | ChemIDplus |
| linoleic acid, ion(1−) | ChemIDplus |
| cis,cis-9,12-octadecadienoate | ChEBI |
| cis,cis-linoleate | ChEBI |
| cis-Δ9,12-octadecadienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (9Z,12Z)-octadecadienoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01595 | KEGG COMPOUND |
| LINOLEIC_ACID | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:667201 | Gmelin |
| Reaxys:4139597 | Reaxys |
| CAS:1509-85-9 | ChemIDplus |