EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8O5 |
| Net Charge | 0 |
| Average Mass | 232.191 |
| Monoisotopic Mass | 232.03717 |
| SMILES | COc1c2occc2c(O)c2ccc(=O)oc12 |
| InChI | InChI=1S/C12H8O5/c1-15-12-10-7(4-5-16-10)9(14)6-2-3-8(13)17-11(6)12/h2-5,14H,1H3 |
| InChIKey | XPFCGZWOHNGDSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyxanthotoxin (CHEBI:2082) has functional parent methoxsalen (CHEBI:18358) |
| 5-hydroxyxanthotoxin (CHEBI:2082) has role metabolite (CHEBI:25212) |
| 5-hydroxyxanthotoxin (CHEBI:2082) is a psoralens (CHEBI:26369) |
| 5-hydroxyxanthotoxin (CHEBI:2082) is conjugate acid of 5-hydroxyxanthotoxin(1−) (CHEBI:78326) |
| Incoming Relation(s) |
| 5-hydroxyxanthotoxin(1−) (CHEBI:78326) is conjugate base of 5-hydroxyxanthotoxin (CHEBI:2082) |
| IUPAC Name |
|---|
| 4-hydroxy-9-methoxy-7H-furo[3,2-g]chromen-7-one |
| Synonyms | Source |
|---|---|
| 4-hydroxy-9-methoxy-7H-furo[3,2-g]benzopyran-7-one | ChEBI |
| 5-hydroxy-8-methoxypsoralen | ChEBI |
| 5-Hydroxyxanthotoxin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02951 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:226874 | Reaxys |
| Citations |
|---|