EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H7O5 |
| Net Charge | -1 |
| Average Mass | 231.183 |
| Monoisotopic Mass | 231.02990 |
| SMILES | COc1c2occc2c([O-])c2ccc(=O)oc12 |
| InChI | InChI=1S/C12H8O5/c1-15-12-10-7(4-5-16-10)9(14)6-2-3-8(13)17-11(6)12/h2-5,14H,1H3/p-1 |
| InChIKey | XPFCGZWOHNGDSP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyxanthotoxin(1−) (CHEBI:78326) is a phenolate anion (CHEBI:50525) |
| 5-hydroxyxanthotoxin(1−) (CHEBI:78326) is conjugate base of 5-hydroxyxanthotoxin (CHEBI:2082) |
| Incoming Relation(s) |
| 5-hydroxyxanthotoxin (CHEBI:2082) is conjugate acid of 5-hydroxyxanthotoxin(1−) (CHEBI:78326) |
| IUPAC Name |
|---|
| 9-methoxy-7-oxo-7H-furo[3,2-g]chromen-4-olate |
| UniProt Name | Source |
|---|---|
| 5-hydroxyxanthotoxin | UniProt |