EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8O4 |
| Net Charge | 0 |
| Average Mass | 216.192 |
| Monoisotopic Mass | 216.04226 |
| SMILES | COc1c2occc2cc2ccc(=O)oc12 |
| InChI | InChI=1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3 |
| InChIKey | QXKHYNVANLEOEG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ammi majus (ncbitaxon:48026) | - | PubMed (15009205) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxsalen (CHEBI:18358) has functional parent psoralen (CHEBI:27616) |
| methoxsalen (CHEBI:18358) has role antineoplastic agent (CHEBI:35610) |
| methoxsalen (CHEBI:18358) has role cross-linking reagent (CHEBI:50684) |
| methoxsalen (CHEBI:18358) has role dermatologic drug (CHEBI:50177) |
| methoxsalen (CHEBI:18358) has role photosensitizing agent (CHEBI:47868) |
| methoxsalen (CHEBI:18358) has role plant metabolite (CHEBI:76924) |
| methoxsalen (CHEBI:18358) is a aromatic ether (CHEBI:35618) |
| methoxsalen (CHEBI:18358) is a psoralens (CHEBI:26369) |
| Incoming Relation(s) |
| 5-hydroxyxanthotoxin (CHEBI:2082) has functional parent methoxsalen (CHEBI:18358) |
| IUPAC Name |
|---|
| 9-methoxy-7H-furo[3,2-g]chromen-7-one |
| Synonyms | Source |
|---|---|
| 6-hydroxy-7-methoxy-5-benzofuranacrylic acid δ-lactone | NIST Chemistry WebBook |
| 8-methoxy-2',3',6,7-furocoumarin | ChemIDplus |
| 8-methoxy-4',5':6,7-furocoumarin | NIST Chemistry WebBook |
| 8-methoxy-[furano-3'.2':6.7-coumarin] | ChemIDplus |
| 8-Methoxyfuranocoumarin | KEGG COMPOUND |
| 8-methoxypsoralen | ChemIDplus |
| Brand Names | Source |
|---|---|
| Meladinine | DrugBank |
| Meloxine | ChemIDplus |
| Oxsoralen | DrugBank |
| Ultra Mop | DrugBank |
| Uvadex | DrugBank |
| UniProt Name | Source |
|---|---|
| xanthotoxin | UniProt |
| Citations |
|---|