EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O5 |
| Net Charge | 0 |
| Average Mass | 284.352 |
| Monoisotopic Mass | 284.16237 |
| SMILES | [H][C@]12OC(O)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C15H24O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-13,16H,4-7H2,1-3H3/t8-,9-,10+,11+,12?,13-,14-,15-/m1/s1 |
| InChIKey | BJDCWCLMFKKGEE-HVDUHBCDSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroartemisinin (CHEBI:207229) has role antimalarial (CHEBI:38068) |
| dihydroartemisinin (CHEBI:207229) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (3R,5aS,6R,8aS,9R,12R,12aR)-3,6,9-trimethyldecahydro-3,12-epoxypyrano[4,3-j][1,2]benzodioxepin-10-ol |
| Synonym | Source |
|---|---|
| 1,5,9-trimethyl-(1R,4S,5R,8S,9R,10S,12R,13R)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-ol(Dihydroartemisinin) | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4185848 | Beilstein |
| Citations |
|---|