EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O5 |
| Net Charge | 0 |
| Average Mass | 284.352 |
| Monoisotopic Mass | 284.16237 |
| SMILES | [H][C@]12O[C@@H](O)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C15H24O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-13,16H,4-7H2,1-3H3/t8-,9-,10+,11+,12-,13-,14-,15-/m1/s1 |
| InChIKey | BJDCWCLMFKKGEE-KDTBHNEXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydroartemisinin (DHA) (CHEBI:168754) is a artemisinin derivative (CHEBI:63920) |
| IUPAC Name |
|---|
| (1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-ol |
| Manual Xrefs | Databases |
|---|---|
| 9533004 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:81496-81-3 | ChemIDplus |