EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O5 |
| Net Charge | 0 |
| Average Mass | 284.352 |
| Monoisotopic Mass | 284.16237 |
| SMILES | [H][C@]12O[C@H](O)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C15H24O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-13,16H,4-7H2,1-3H3/t8-,9-,10+,11+,12+,13-,14-,15-/m1/s1 |
| InChIKey | BJDCWCLMFKKGEE-ISOSDAIHSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-dihydroartemisinin (CHEBI:135921) is a dihydroartemisinin (CHEBI:207229) |
| IUPAC Name |
|---|
| (3R,5aS,6R,8aS,9R,10S,12R,12aR)-3,6,9-trimethyldecahydro-3,12-epoxy[1,2]dioxepino[4,3-i]isochromen-10-ol |
| Synonyms | Source |
|---|---|
| (3R,5aS,6R,8aS,9R,10S,12R,12aR)-3,6,9-trimethyldecahydro-12H-3,12-epoxypyrano[4,3-j][1,2]benzodioxepin-10-ol | IUPAC |
| alaxin | DrugCentral |
| artenimol | ChEBI |
| beta-Dihydroartemisinin | DrugCentral |
| cotecxin | DrugCentral |
| cotexin | DrugCentral |