EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17602 - 4-aminophenol
| Formula | C6H7NO |
| Net Charge | 0 |
| Average Mass | 109.128 |
| Monoisotopic Mass | 109.05276 |
| SMILES | Nc1ccc(O)cc1 |
| InChI | InChI=1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2 |
| InChIKey | PLIKAWJENQZMHA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminophenol (CHEBI:17602) has role allergen (CHEBI:50904) |
| 4-aminophenol (CHEBI:17602) has role metabolite (CHEBI:25212) |
| 4-aminophenol (CHEBI:17602) is a aminophenol (CHEBI:28829) |
| Incoming Relation(s) |
| 4-methylaminophenol (CHEBI:55416) has functional parent 4-aminophenol (CHEBI:17602) |
| aminoparathion (CHEBI:28055) has functional parent 4-aminophenol (CHEBI:17602) |
| paracetamol (CHEBI:46195) has functional parent 4-aminophenol (CHEBI:17602) |
| IUPAC Name |
|---|
| 4-aminophenol |
| Synonyms | Source |
|---|---|
| 4-Aminobenzenol | KEGG COMPOUND |
| 4-Aminophenol | KEGG COMPOUND |
| 4-AMINOPHENOL | PDBeChem |
| 4-Hydroxyaniline | KEGG COMPOUND |
| p-hydroxyaniline | NIST Chemistry WebBook |
| p-Aminophenol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 4-aminophenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4-Aminophenol | Wikipedia |
| 4NL | PDBeChem |
| c0090 | UM-BBD |
| C02372 | KEGG COMPOUND |
| C02372 | KEGG COMPOUND |
| CPD-259 | MetaCyc |
| HMDB0001169 | HMDB |
| Citations |
|---|