EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16NO3PS |
| Net Charge | 0 |
| Average Mass | 261.283 |
| Monoisotopic Mass | 261.05885 |
| SMILES | CCOP(=S)(OCC)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C10H16NO3PS/c1-3-12-15(16,13-4-2)14-10-7-5-9(11)6-8-10/h5-8H,3-4,11H2,1-2H3 |
| InChIKey | XIZOTXGJXSTQDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminoparathion (CHEBI:28055) has functional parent 4-aminophenol (CHEBI:17602) |
| aminoparathion (CHEBI:28055) has functional parent parathion (CHEBI:27928) |
| aminoparathion (CHEBI:28055) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| aminoparathion (CHEBI:28055) has role environmental contaminant (CHEBI:78298) |
| aminoparathion (CHEBI:28055) has role human xenobiotic metabolite (CHEBI:76967) |
| aminoparathion (CHEBI:28055) is a organic thiophosphate (CHEBI:37512) |
| aminoparathion (CHEBI:28055) is a organothiophosphate insecticide (CHEBI:25715) |
| aminoparathion (CHEBI:28055) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| O-(4-aminophenyl) O,O-diethyl phosphorothioate |
| Synonyms | Source |
|---|---|
| 4-aminoparathion | ChEBI |
| amino-parathion | MetaCyc |
| E 605 reduced | ChemIDplus |
| O,O-diethyl O-(4-aminophenyl) phosphorothioate | ChemIDplus |
| p-aminoparathion | ChemIDplus |
| parathion amino | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 215 | ChemSpider |
| AMINO-PARATHION | MetaCyc |
| c0089 | UM-BBD |
| C06605 | KEGG COMPOUND |
| FDB022660 | FooDB |
| HMDB0001504 | HMDB |
| Citations |
|---|