EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO |
| Net Charge | 0 |
| Average Mass | 123.155 |
| Monoisotopic Mass | 123.06841 |
| SMILES | CNc1ccc(O)cc1 |
| InChI | InChI=1S/C7H9NO/c1-8-6-2-4-7(9)5-3-6/h2-5,8-9H,1H3 |
| InChIKey | ZFIQGRISGKSVAG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylaminophenol (CHEBI:55416) has functional parent 4-aminophenol (CHEBI:17602) |
| 4-methylaminophenol (CHEBI:55416) has role allergen (CHEBI:50904) |
| 4-methylaminophenol (CHEBI:55416) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 4-methylaminophenol sulfate (CHEBI:55413) has functional parent 4-methylaminophenol (CHEBI:55416) |
| IUPAC Name |
|---|
| 4-(methylamino)phenol |
| Synonyms | Source |
|---|---|
| N-methyl-4-hydroxyaniline | ChEBI |
| Metol | ChemIDplus |
| N-Methyl-4-aminophenol | ChemIDplus |
| n-Methyl-p-aminophenol | ChemIDplus |
| N-Methyl-p-aminophenol | ChemIDplus |
| Paramethylaminophenol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1363740 | Reaxys |
| Gmelin:694338 | Gmelin |
| CAS:150-75-4 | ChemIDplus |
| Citations |
|---|