EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | CC(O)CC(=O)O |
| InChI | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7) |
| InChIKey | WHBMMWSBFZVSSR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxybutyric acid (CHEBI:20067) has functional parent butyric acid (CHEBI:30772) |
| 3-hydroxybutyric acid (CHEBI:20067) has role human metabolite (CHEBI:77746) |
| 3-hydroxybutyric acid (CHEBI:20067) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 3-hydroxybutyric acid (CHEBI:20067) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxybutyric acid (CHEBI:20067) is a hydroxybutyric acid (CHEBI:24684) |
| 3-hydroxybutyric acid (CHEBI:20067) is conjugate acid of 3-hydroxybutyrate (CHEBI:37054) |
| Incoming Relation(s) |
| (R)-3-hydroxybutyrylcarnitine (CHEBI:84842) has functional parent 3-hydroxybutyric acid (CHEBI:20067) |
| 3-hydroxybutanoyl-CoA (CHEBI:37050) has functional parent 3-hydroxybutyric acid (CHEBI:20067) |
| curtisian C (CHEBI:65698) has functional parent 3-hydroxybutyric acid (CHEBI:20067) |
| curtisian D (CHEBI:65699) has functional parent 3-hydroxybutyric acid (CHEBI:20067) |
| ethyl 3-hydroxybutyrate (CHEBI:87685) has functional parent 3-hydroxybutyric acid (CHEBI:20067) |
| fleephilone (CHEBI:65900) has functional parent 3-hydroxybutyric acid (CHEBI:20067) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) is a 3-hydroxybutyric acid (CHEBI:20067) |
| (S)-3-hydroxybutyric acid (CHEBI:17290) is a 3-hydroxybutyric acid (CHEBI:20067) |
| 3-hydroxybutyrate (CHEBI:37054) is conjugate base of 3-hydroxybutyric acid (CHEBI:20067) |
| IUPAC Name |
|---|
| 3-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| (1)-3-Hydroxybutyric acid | ChemIDplus |
| 3 HBA | ChemIDplus |
| 3-Hydroxybuttersaeure | ChemIDplus |
| 3-OH-butyric acid | ChEBI |
| beta-Hydroxybuttersaeure | ChemIDplus |
| beta-Hydroxy-n-butyric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 3-hydroxybutyrate | Wikipedia |
| HMDB0000357 | HMDB |
| LMFA01050005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:773861 | Reaxys |
| CAS:300-85-6 | ChemIDplus |
| Citations |
|---|