EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H38O15 |
| Net Charge | 0 |
| Average Mass | 710.685 |
| Monoisotopic Mass | 710.22107 |
| SMILES | CC(=O)Oc1c(OC(=O)CC(C)OC(C)=O)c(-c2ccc(O)cc2)c(OC(=O)CC(C)O)c(OC(=O)CC(C)OC(C)=O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C36H38O15/c1-18(37)15-28(43)49-36-32(25-9-13-27(42)14-10-25)34(50-29(44)16-19(2)46-21(4)38)33(48-23(6)40)31(24-7-11-26(41)12-8-24)35(36)51-30(45)17-20(3)47-22(5)39/h7-14,18-20,37,41-42H,15-17H2,1-6H3 |
| InChIKey | OOCWZGJDLBNMPT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paxillus curtisii (ncbitaxon:217300) | fruit body (BTO:0000487) | PubMed (10805570) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| curtisian C (CHEBI:65698) has functional parent 3-hydroxybutyric acid (CHEBI:20067) |
| curtisian C (CHEBI:65698) has parent hydride 1,4-diphenylbenzene (CHEBI:52242) |
| curtisian C (CHEBI:65698) has role metabolite (CHEBI:25212) |
| curtisian C (CHEBI:65698) has role radical scavenger (CHEBI:48578) |
| curtisian C (CHEBI:65698) is a para-terphenyl (CHEBI:75874) |
| curtisian C (CHEBI:65698) is a acetate ester (CHEBI:47622) |
| curtisian C (CHEBI:65698) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3'-(acetyloxy)-4,4''-dihydroxy-6'-[(3-hydroxybutanoyl)oxy]-1,1':4',1''-terphenyl-2',5'-diyl bis[3-(acetyloxy)butanoate] |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8603643 | Reaxys |
| Citations |
|---|