EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O3 |
| Net Charge | -1 |
| Average Mass | 103.097 |
| Monoisotopic Mass | 103.04007 |
| SMILES | CC(O)CC(=O)[O-] |
| InChI | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1 |
| InChIKey | WHBMMWSBFZVSSR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxybutyrate (CHEBI:37054) has functional parent butyrate (CHEBI:17968) |
| 3-hydroxybutyrate (CHEBI:37054) has role human metabolite (CHEBI:77746) |
| 3-hydroxybutyrate (CHEBI:37054) is a 3-hydroxy fatty acid anion (CHEBI:84196) |
| 3-hydroxybutyrate (CHEBI:37054) is conjugate base of 3-hydroxybutyric acid (CHEBI:20067) |
| Incoming Relation(s) |
| sodium 3-hydroxybutyrate (CHEBI:113373) has part 3-hydroxybutyrate (CHEBI:37054) |
| (R)-3-hydroxybutyrate (CHEBI:10983) is a 3-hydroxybutyrate (CHEBI:37054) |
| (S)-3-hydroxybutyrate (CHEBI:11047) is a 3-hydroxybutyrate (CHEBI:37054) |
| 3-hydroxybutyric acid (CHEBI:20067) is conjugate acid of 3-hydroxybutyrate (CHEBI:37054) |
| IUPAC Name |
|---|
| 3-hydroxybutanoate |
| Synonyms | Source |
|---|---|
| 3-OH butyrate | ChEBI |
| 3-OH-butyrate | ChEBI |
| DL-3-hydroxybutyrate | ChEBI |
| β-hydroxybutanoate | ChEBI |
| β-hydroxy-n-butyrate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-hydroxybutanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4127635 | Reaxys |