EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:19929 - 3-hydroxy-3-phenylpropionic acid
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | O=C(O)CC(O)c1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChIKey | AYOLELPCNDVZKZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) has functional parent 3-phenylpropionic acid (CHEBI:28631) |
| 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) is a monocarboxylic acid (CHEBI:25384) |
| 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) is conjugate acid of 3-hydroxy-3-phenylpropionate (CHEBI:63469) |
| Incoming Relation(s) |
| 3-hydroxy-3-phenylpropionyl-CoA (CHEBI:71290) has functional parent 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) |
| ethyl 2-hydroxy-3-phenylpropanoate (CHEBI:87513) has functional parent 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) |
| (R)-3-hydroxy-3-phenylpropionic acid (CHEBI:51059) is a 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) |
| (S)-3-hydroxy-3-phenylpropionic acid (CHEBI:51058) is a 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) |
| 3-hydroxy-3-phenylpropionate (CHEBI:63469) is conjugate base of 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) |
| IUPAC Name |
|---|
| 3-hydroxy-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-12218 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3197774 | Reaxys |
| Citations |
|---|