EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O3 |
| Net Charge | 0 |
| Average Mass | 194.230 |
| Monoisotopic Mass | 194.09429 |
| SMILES | CCOC(=O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C11H14O3/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9/h3-7,10,12H,2,8H2,1H3 |
| InChIKey | HBOGUIFRIAXYNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 2-hydroxy-3-phenylpropanoate (CHEBI:87513) has functional parent 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) |
| ethyl 2-hydroxy-3-phenylpropanoate (CHEBI:87513) has role metabolite (CHEBI:25212) |
| ethyl 2-hydroxy-3-phenylpropanoate (CHEBI:87513) is a benzenes (CHEBI:22712) |
| ethyl 2-hydroxy-3-phenylpropanoate (CHEBI:87513) is a carboxylic ester (CHEBI:33308) |
| IUPAC Name |
|---|
| ethyl 2-hydroxy-3-phenylpropanoate |
| Synonym | Source |
|---|---|
| 3-phenyllactic acid ethyl ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2212887 | Reaxys |
| CAS:15399-05-0 | ChemIDplus |