EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | O=C(O)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m1/s1 |
| InChIKey | AYOLELPCNDVZKZ-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-hydroxy-3-phenylpropionic acid (CHEBI:51059) is a 3-hydroxy-3-phenylpropionic acid (CHEBI:19929) |
| (R)-3-hydroxy-3-phenylpropionic acid (CHEBI:51059) is enantiomer of (S)-3-hydroxy-3-phenylpropionic acid (CHEBI:51058) |
| Incoming Relation(s) |
| (S)-3-hydroxy-3-phenylpropionic acid (CHEBI:51058) is enantiomer of (R)-3-hydroxy-3-phenylpropionic acid (CHEBI:51059) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-3-phenylpropanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3197772 | Beilstein |